C35H33BeN3O2+2 — CID 143983992
beryllium;benzo[h]quinolin-1-ium-10-olate;2-[5-[(1Z)-buta-1,3-dienyl]-4-ethyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imidazol-3-ium-2-yl]phenolate (PubChem CID 143983992) has the molecular formula C35H33BeN3O2+2 and a molecular weight of 536.68 g/mol. Its IUPAC name is beryllium;benzo[h]quinolin-1-ium-10-olate;2-[5-[(1Z)-buta-1,3-dienyl]-4-ethyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imidazol-3-ium-2-yl]phenolate.
| Compound Name | beryllium;benzo[h]quinolin-1-ium-10-olate;2-[5-[(1Z)-buta-1,3-dienyl]-4-ethyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imidazol-3-ium-2-yl]phenolate |
|---|---|
| PubChem CID | 143983992 |
| Molecular Formula | C35H33BeN3O2+2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | beryllium;benzo[h]quinolin-1-ium-10-olate;2-[5-[(1Z)-buta-1,3-dienyl]-4-ethyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]imidazol-3-ium-2-yl]phenolate |
| SMILES | C=C/C=C\c1c(CC)[nH+]c(-c2ccccc2[O-])n1C(/C=C\C)=C/C=C.[Be+2].[O-]c1cccc2ccc3ccc[nH+]c3c12 |
| InChI | InChI=1S/C22H24N2O.C13H9NO.Be/c1-5-9-15-20-19(8-4)23-22(18-14-10-11-16-21(18)25)24(20)17(12-6-2)13-7-3;15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h5-7,9-16,25H,1-2,8H2,3-4H3;1-8,15H;/q;;+2/b13-7-,15-9-,17-12+;; |
| InChIKey | WLSJDNQXONZUDO-HWUJKIJPSA-N |
| XLogP | 5.91 |
| TPSA | 79.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|