C44H28LiN4O+ — CID 140600485
lithium 5-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate (PubChem CID 140600485) has the molecular formula C44H28LiN4O+ and a molecular weight of 635.68 g/mol. Its IUPAC name is lithium 5-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600485 |
| Molecular Formula | C44H28LiN4O+ |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | lithium 5-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]anthracen-9-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2c3ccccc3cc3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C44H28N4O.Li/c49-39-24-23-36(37-16-9-25-45-41(37)39)40-35-15-8-7-14-33(35)26-34-22-21-32(27-38(34)40)28-17-19-31(20-18-28)44-47-42(29-10-3-1-4-11-29)46-43(48-44)30-12-5-2-6-13-30;/h1-27,49H;/q;+1 |
| InChIKey | NYNNCJASCVCXNZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|