C40H24LiN4O+ — CID 140600506
lithium 5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)pyren-1-yl]quinolin-1-ium-8-olate (PubChem CID 140600506) has the molecular formula C40H24LiN4O+ and a molecular weight of 583.60 g/mol. Its IUPAC name is lithium 5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)pyren-1-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)pyren-1-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600506 |
| Molecular Formula | C40H24LiN4O+ |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | lithium 5-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)pyren-1-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2ccc3ccc4c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc5ccc2c3c54)c2ccc[nH+]c12 |
| InChI | InChI=1S/C40H24N4O.Li/c45-34-22-21-29(32-12-7-23-41-37(32)34)28-17-13-24-15-19-31-33(20-16-25-14-18-30(28)35(24)36(25)31)40-43-38(26-8-3-1-4-9-26)42-39(44-40)27-10-5-2-6-11-27;/h1-23,45H;/q;+1 |
| InChIKey | MZEWMEKJLUPRJT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|