C53H33LiN3O+ — CID 140600520
lithium 5-[2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]quinolin-1-ium-8-olate (PubChem CID 140600520) has the molecular formula C53H33LiN3O+ and a molecular weight of 734.81 g/mol. Its IUPAC name is lithium 5-[2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]quinolin-1-ium-8-olate.
| Compound Name | lithium 5-[2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600520 |
| Molecular Formula | C53H33LiN3O+ |
| Molecular Weight | 734.81 g/mol |
| Exact Mass | 734.28 |
| IUPAC Name | lithium 5-[2-[4-(1-phenylbenzimidazol-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[O-]c1ccc(-c2ccc3c(c2)C2(c4ccccc4-c4ccc(-c5ccc(-c6nc7ccccc7n6-c6ccccc6)cc5)cc42)c2ccccc2-3)c2ccc[nH+]c12 |
| InChI | InChI=1S/C53H33N3O.Li/c57-50-29-28-38(43-15-10-30-54-51(43)50)36-25-27-42-40-14-5-7-17-45(40)53(47(42)32-36)44-16-6-4-13-39(44)41-26-24-35(31-46(41)53)33-20-22-34(23-21-33)52-55-48-18-8-9-19-49(48)56(52)37-11-2-1-3-12-37;/h1-32,57H;/q;+1 |
| InChIKey | IAUSJIGFARMPJI-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |