C39H23Li2N3O3+2 — CID 140600524
dilithium;7-[3-(1,3-benzoxazol-2-yl)-10-(8-oxidoquinolin-1-ium-7-yl)anthracen-9-yl]quinolin-1-ium-8-olate (PubChem CID 140600524) has the molecular formula C39H23Li2N3O3+2 and a molecular weight of 595.51 g/mol. Its IUPAC name is dilithium;7-[3-(1,3-benzoxazol-2-yl)-10-(8-oxidoquinolin-1-ium-7-yl)anthracen-9-yl]quinolin-1-ium-8-olate.
| Compound Name | dilithium;7-[3-(1,3-benzoxazol-2-yl)-10-(8-oxidoquinolin-1-ium-7-yl)anthracen-9-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600524 |
| Molecular Formula | C39H23Li2N3O3+2 |
| Molecular Weight | 595.51 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | dilithium;7-[3-(1,3-benzoxazol-2-yl)-10-(8-oxidoquinolin-1-ium-7-yl)anthracen-9-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[Li+].[O-]c1c(-c2c3ccccc3c(-c3ccc4ccc[nH+]c4c3[O-])c3cc(-c4nc5ccccc5o4)ccc23)ccc2ccc[nH+]c12 |
| InChI | InChI=1S/C39H23N3O3.2Li/c43-37-28(17-13-22-7-5-19-40-35(22)37)33-25-9-1-2-10-26(25)34(29-18-14-23-8-6-20-41-36(23)38(29)44)30-21-24(15-16-27(30)33)39-42-31-11-3-4-12-32(31)45-39;;/h1-21,43-44H;;/q;2*+1 |
| InChIKey | QEHUBVVNXHWBMB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|