C55H34Li2N4O2+2 — CID 140600540
dilithium;5-[12-(8-oxidoquinolin-1-ium-5-yl)-4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate (PubChem CID 140600540) has the molecular formula C55H34Li2N4O2+2 and a molecular weight of 796.79 g/mol. Its IUPAC name is dilithium;5-[12-(8-oxidoquinolin-1-ium-5-yl)-4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate.
| Compound Name | dilithium;5-[12-(8-oxidoquinolin-1-ium-5-yl)-4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140600540 |
| Molecular Formula | C55H34Li2N4O2+2 |
| Molecular Weight | 796.79 g/mol |
| Exact Mass | 796.30 |
| IUPAC Name | dilithium;5-[12-(8-oxidoquinolin-1-ium-5-yl)-4-[4-(1-phenylbenzimidazol-2-yl)phenyl]benzo[a]anthracen-7-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[Li+].[O-]c1ccc(-c2c3ccccc3c(-c3ccc([O-])c4[nH+]cccc34)c3c2ccc2c(-c4ccc(-c5nc6ccccc6n5-c5ccccc5)cc4)cccc23)c2ccc[nH+]c12 |
| InChI | InChI=1S/C55H34N4O2.2Li/c60-48-29-27-41(43-17-9-31-56-53(43)48)50-39-13-4-5-14-40(39)51(42-28-30-49(61)54-44(42)18-10-32-57-54)52-38-16-8-15-36(37(38)25-26-45(50)52)33-21-23-34(24-22-33)55-58-46-19-6-7-20-47(46)59(55)35-11-2-1-3-12-35;;/h1-32,60-61H;;/q;2*+1 |
| InChIKey | XDMIRDLWPFWONB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 92.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|