C24H22FN3O4S — CID 140601098
N-[4-[2-acetyl-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide (PubChem CID 140601098) has the molecular formula C24H22FN3O4S and a molecular weight of 467.52 g/mol. Its IUPAC name is N-[4-[2-acetyl-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide.
| Compound Name | N-[4-[2-acetyl-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 140601098 |
| Molecular Formula | C24H22FN3O4S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-[4-[2-acetyl-3-(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide |
| SMILES | COc1cccc(C2CC(c3ccc(N(F)S(=O)(=O)c4ccccc4)cc3)=NN2C(C)=O)c1 |
| InChI | InChI=1S/C24H22FN3O4S/c1-17(29)27-24(19-7-6-8-21(15-19)32-2)16-23(26-27)18-11-13-20(14-12-18)28(25)33(30,31)22-9-4-3-5-10-22/h3-15,24H,16H2,1-2H3 |
| InChIKey | TWUFXTOHXSOEOW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|