C23H21FN4O3S — CID 140601109
N-[4-[2-acetyl-3-(4-aminophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide (PubChem CID 140601109) has the molecular formula C23H21FN4O3S and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[4-[2-acetyl-3-(4-aminophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide.
| Compound Name | N-[4-[2-acetyl-3-(4-aminophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 140601109 |
| Molecular Formula | C23H21FN4O3S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[4-[2-acetyl-3-(4-aminophenyl)-3,4-dihydropyrazol-5-yl]phenyl]-N-fluorobenzenesulfonamide |
| SMILES | CC(=O)N1N=C(c2ccc(N(F)S(=O)(=O)c3ccccc3)cc2)CC1c1ccc(N)cc1 |
| InChI | InChI=1S/C23H21FN4O3S/c1-16(29)27-23(18-7-11-19(25)12-8-18)15-22(26-27)17-9-13-20(14-10-17)28(24)32(30,31)21-5-3-2-4-6-21/h2-14,23H,15,25H2,1H3 |
| InChIKey | WUDNJNJXHVFBCR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|