C19H23IrN3-2 — CID 140602853
3-(4-tert-butylbenzene-6-id-1-yl)-1-propan-2-yl-2H-imidazo[4,5-b]pyridin-2-ide;iridium (PubChem CID 140602853) has the molecular formula C19H23IrN3-2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-(4-tert-butylbenzene-6-id-1-yl)-1-propan-2-yl-2H-imidazo[4,5-b]pyridin-2-ide;iridium.
| Compound Name | 3-(4-tert-butylbenzene-6-id-1-yl)-1-propan-2-yl-2H-imidazo[4,5-b]pyridin-2-ide;iridium |
|---|---|
| PubChem CID | 140602853 |
| Molecular Formula | C19H23IrN3-2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 3-(4-tert-butylbenzene-6-id-1-yl)-1-propan-2-yl-2H-imidazo[4,5-b]pyridin-2-ide;iridium |
| SMILES | CC(C)N1[CH-]N(c2[c-]cc(C(C)(C)C)cc2)c2ncccc21.[Ir] |
| InChI | InChI=1S/C19H23N3.Ir/c1-14(2)21-13-22(18-17(21)7-6-12-20-18)16-10-8-15(9-11-16)19(3,4)5;/h6-10,12-14H,1-5H3;/q-2; |
| InChIKey | QBDRPIOZOXGCHP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|