C27H30IrN2 — CID 58986766
1-(4-tert-butylbenzene-6-id-1-yl)-3-(4-tert-butylphenyl)-2H-benzimidazol-2-ylium;iridium (PubChem CID 58986766) has the molecular formula C27H30IrN2 and a molecular weight of 574.77 g/mol. Its IUPAC name is 1-(4-tert-butylbenzene-6-id-1-yl)-3-(4-tert-butylphenyl)-2H-benzimidazol-2-ylium;iridium.
| Compound Name | 1-(4-tert-butylbenzene-6-id-1-yl)-3-(4-tert-butylphenyl)-2H-benzimidazol-2-ylium;iridium |
|---|---|
| PubChem CID | 58986766 |
| Molecular Formula | C27H30IrN2 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 1-(4-tert-butylbenzene-6-id-1-yl)-3-(4-tert-butylphenyl)-2H-benzimidazol-2-ylium;iridium |
| SMILES | CC(C)(C)c1c[c-]c(-n2[cH+]n(-c3ccc(C(C)(C)C)cc3)c3ccccc32)cc1.[Ir] |
| InChI | InChI=1S/C27H30N2.Ir/c1-26(2,3)20-11-15-22(16-12-20)28-19-29(25-10-8-7-9-24(25)28)23-17-13-21(14-18-23)27(4,5)6;/h7-17,19H,1-6H3; |
| InChIKey | HPUVPIPCIZBUPG-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|