C8H11NO — CID 140603916
2-(methyliminomethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 140603916) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-(methyliminomethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 2-(methyliminomethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 140603916 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-(methyliminomethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | C/N=C/C1=CC=CCC1O |
| InChI | InChI=1S/C8H11NO/c1-9-6-7-4-2-3-5-8(7)10/h2-4,6,8,10H,5H2,1H3/b9-6+ |
| InChIKey | CKGVLUIREPANEL-RMKNXTFCSA-N |
| XLogP | 0.93 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|