C9H10N2O — CID 123530431
(4-hydroxy-3-methylcyclohexa-1,5-dien-1-yl)methylidenecyanamide (PubChem CID 123530431) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is (4-hydroxy-3-methylcyclohexa-1,5-dien-1-yl)methylidenecyanamide.
| Compound Name | (4-hydroxy-3-methylcyclohexa-1,5-dien-1-yl)methylidenecyanamide |
|---|---|
| PubChem CID | 123530431 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (4-hydroxy-3-methylcyclohexa-1,5-dien-1-yl)methylidenecyanamide |
| SMILES | CC1C=C(/C=N/C#N)C=CC1O |
| InChI | InChI=1S/C9H10N2O/c1-7-4-8(5-11-6-10)2-3-9(7)12/h2-5,7,9,12H,1H3/b11-5+ |
| InChIKey | FTLGWUQFQUVREQ-VZUCSPMQSA-N |
| XLogP | 1.03 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|