C16H20N2O2 — CID 142930611
2-[2-[(6-hydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-2,4-dien-1-ol (PubChem CID 142930611) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[2-[(6-hydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-2,4-dien-1-ol.
| Compound Name | 2-[2-[(6-hydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 142930611 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[2-[(6-hydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-2,4-dien-1-ol |
| SMILES | OC1CC=CC=C1/C=N/CC/N=C/C1C=CC=CC1O |
| InChI | InChI=1S/C16H20N2O2/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20/h1-7,11-13,15-16,19-20H,8-10H2/b17-11+,18-12+ |
| InChIKey | YDWPMRZANRAQFO-JYFOCSDGSA-N |
| XLogP | 1.48 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|