C10H15NO — CID 163719440
(4E,6E)-4-(methyliminomethyl)octa-1,4,6-trien-3-ol (PubChem CID 163719440) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (4E,6E)-4-(methyliminomethyl)octa-1,4,6-trien-3-ol.
| Compound Name | (4E,6E)-4-(methyliminomethyl)octa-1,4,6-trien-3-ol |
|---|---|
| PubChem CID | 163719440 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (4E,6E)-4-(methyliminomethyl)octa-1,4,6-trien-3-ol |
| SMILES | C=CC(O)C(/C=N/C)=C/C=C/C |
| InChI | InChI=1S/C10H15NO/c1-4-6-7-9(8-11-3)10(12)5-2/h4-8,10,12H,2H2,1,3H3/b6-4+,9-7+,11-8+ |
| InChIKey | KQFXOGLJHUJHSU-CKOLANTHSA-N |
| XLogP | 1.74 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|