C25H23NO7 — CID 140603946
(4E)-9,12-dihydroxy-11-[(1S)-1-hydroxy-2-[[(2S)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]-2,7-dioxabicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene-3,6-dione (PubChem CID 140603946) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is (4E)-9,12-dihydroxy-11-[(1S)-1-hydroxy-2-[[(2S)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]-2,7-dioxabicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene-3,6-dione.
| Compound Name | (4E)-9,12-dihydroxy-11-[(1S)-1-hydroxy-2-[[(2S)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]-2,7-dioxabicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene-3,6-dione |
|---|---|
| PubChem CID | 140603946 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (4E)-9,12-dihydroxy-11-[(1S)-1-hydroxy-2-[[(2S)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]-2,7-dioxabicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene-3,6-dione |
| SMILES | C[C@@H](Cc1cccc2ccccc12)NC[C@@H](O)c1cc(O)c2c(O)c1OC(=O)/C=C\C(=O)O2 |
| InChI | InChI=1S/C25H23NO7/c1-14(11-16-7-4-6-15-5-2-3-8-17(15)16)26-13-20(28)18-12-19(27)25-23(31)24(18)32-21(29)9-10-22(30)33-25/h2-10,12,14,20,26-28,31H,11,13H2,1H3/b10-9-/t14-,20+/m0/s1 |
| InChIKey | DZZAECXRZICXHV-WLQQGUILSA-N |
| XLogP | 2.89 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|