C25H27NO7 — CID 67539129
but-2-enedioic acid;5-[(1S)-1-hydroxy-2-[[(2R)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]benzene-1,3-diol (PubChem CID 67539129) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is but-2-enedioic acid;5-[(1S)-1-hydroxy-2-[[(2R)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]benzene-1,3-diol.
| Compound Name | but-2-enedioic acid;5-[(1S)-1-hydroxy-2-[[(2R)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 67539129 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | but-2-enedioic acid;5-[(1S)-1-hydroxy-2-[[(2R)-1-naphthalen-1-ylpropan-2-yl]amino]ethyl]benzene-1,3-diol |
| SMILES | C[C@H](Cc1cccc2ccccc12)NC[C@@H](O)c1cc(O)cc(O)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C21H23NO3.C4H4O4/c1-14(9-16-7-4-6-15-5-2-3-8-20(15)16)22-13-21(25)17-10-18(23)12-19(24)11-17;5-3(6)1-2-4(7)8/h2-8,10-12,14,21-25H,9,13H2,1H3;1-2H,(H,5,6)(H,7,8)/t14-,21-;/m1./s1 |
| InChIKey | VHTPTYDENQQKIZ-WMNVBSAQSA-N |
| XLogP | 3.22 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|