C18H27N3O — CID 140608181
3-[amino(quinolin-4-yl)amino]-3,5-dimethylheptan-1-ol (PubChem CID 140608181) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-[amino(quinolin-4-yl)amino]-3,5-dimethylheptan-1-ol.
| Compound Name | 3-[amino(quinolin-4-yl)amino]-3,5-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 140608181 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 3-[amino(quinolin-4-yl)amino]-3,5-dimethylheptan-1-ol |
| SMILES | CCC(C)CC(C)(CCO)N(N)c1ccnc2ccccc12 |
| InChI | InChI=1S/C18H27N3O/c1-4-14(2)13-18(3,10-12-22)21(19)17-9-11-20-16-8-6-5-7-15(16)17/h5-9,11,14,22H,4,10,12-13,19H2,1-3H3 |
| InChIKey | MDMZPPKBDYZNPT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|