C14H19N3 — CID 55241600
N'-propyl-N'-quinolin-4-ylethane-1,2-diamine (PubChem CID 55241600) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N'-propyl-N'-quinolin-4-ylethane-1,2-diamine.
| Compound Name | N'-propyl-N'-quinolin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 55241600 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N'-propyl-N'-quinolin-4-ylethane-1,2-diamine |
| SMILES | CCCN(CCN)c1ccnc2ccccc12 |
| InChI | InChI=1S/C14H19N3/c1-2-10-17(11-8-15)14-7-9-16-13-6-4-3-5-12(13)14/h3-7,9H,2,8,10-11,15H2,1H3 |
| InChIKey | KXHXLVBDCDQCRK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |