C17H25N3 — CID 79240886
N'-pentan-3-yl-N'-(quinolin-4-ylmethyl)ethane-1,2-diamine (PubChem CID 79240886) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is N'-pentan-3-yl-N'-(quinolin-4-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-pentan-3-yl-N'-(quinolin-4-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79240886 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N'-pentan-3-yl-N'-(quinolin-4-ylmethyl)ethane-1,2-diamine |
| SMILES | CCC(CC)N(CCN)Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C17H25N3/c1-3-15(4-2)20(12-10-18)13-14-9-11-19-17-8-6-5-7-16(14)17/h5-9,11,15H,3-4,10,12-13,18H2,1-2H3 |
| InChIKey | IHVCXSLHTCAXGG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |