C13H23N3O4 — CID 140608873
1-[(3S)-1-(2-methoxyethylamino)-1,2-dioxopentan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 140608873) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[(3S)-1-(2-methoxyethylamino)-1,2-dioxopentan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(3S)-1-(2-methoxyethylamino)-1,2-dioxopentan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140608873 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[(3S)-1-(2-methoxyethylamino)-1,2-dioxopentan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC[C@@H](C(=O)C(=O)NCCOC)N1CCCC1C(N)=O |
| InChI | InChI=1S/C13H23N3O4/c1-3-9(11(17)13(19)15-6-8-20-2)16-7-4-5-10(16)12(14)18/h9-10H,3-8H2,1-2H3,(H2,14,18)(H,15,19)/t9-,10?/m0/s1 |
| InChIKey | XHAULNYVRSJIPC-RGURZIINSA-N |
| XLogP | -0.95 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|