C30H35Cl2N3O6S — CID 140608874
2-[(3S)-1-(butylamino)-1,2-dioxopentan-3-yl]-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 140608874) has the molecular formula C30H35Cl2N3O6S and a molecular weight of 636.60 g/mol. Its IUPAC name is 2-[(3S)-1-(butylamino)-1,2-dioxopentan-3-yl]-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | 2-[(3S)-1-(butylamino)-1,2-dioxopentan-3-yl]-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140608874 |
| Molecular Formula | C30H35Cl2N3O6S |
| Molecular Weight | 636.60 g/mol |
| Exact Mass | 635.16 |
| IUPAC Name | 2-[(3S)-1-(butylamino)-1,2-dioxopentan-3-yl]-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=O)C(=O)[C@@H](CC)C1(C(N)=O)CC(S(=O)(=O)c2ccccc2Cl)CN1C(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C30H35Cl2N3O6S/c1-3-5-16-34-26(37)25(36)22(4-2)30(27(33)38)17-21(42(40,41)24-9-7-6-8-23(24)32)18-35(30)28(39)29(14-15-29)19-10-12-20(31)13-11-19/h6-13,21-22H,3-5,14-18H2,1-2H3,(H2,33,38)(H,34,37)/t21?,22-,30?/m1/s1 |
| InChIKey | ZWYLYELLRMLYNK-QTYVGJCJSA-N |
| XLogP | 3.84 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|