C33H39Cl2NO6S — CID 160832479
(3R)-1-[(2S,4R)-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-3-propyldecane-1,4,5-trione (PubChem CID 160832479) has the molecular formula C33H39Cl2NO6S and a molecular weight of 648.65 g/mol. Its IUPAC name is (3R)-1-[(2S,4R)-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-3-propyldecane-1,4,5-trione.
| Compound Name | (3R)-1-[(2S,4R)-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-3-propyldecane-1,4,5-trione |
|---|---|
| PubChem CID | 160832479 |
| Molecular Formula | C33H39Cl2NO6S |
| Molecular Weight | 648.65 g/mol |
| Exact Mass | 647.19 |
| IUPAC Name | (3R)-1-[(2S,4R)-1-[1-(4-chlorophenyl)cyclopropanecarbonyl]-4-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-3-propyldecane-1,4,5-trione |
| SMILES | CCCCCC(=O)C(=O)[C@H](CCC)CC(=O)[C@@H]1C[C@@H](S(=O)(=O)c2ccccc2Cl)CN1C(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C33H39Cl2NO6S/c1-3-5-6-11-28(37)31(39)22(9-4-2)19-29(38)27-20-25(43(41,42)30-12-8-7-10-26(30)35)21-36(27)32(40)33(17-18-33)23-13-15-24(34)16-14-23/h7-8,10,12-16,22,25,27H,3-6,9,11,17-21H2,1-2H3/t22-,25-,27+/m1/s1 |
| InChIKey | SGYZNVQTHVNNQI-JBBQQGGESA-N |
| XLogP | 6.56 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|