About 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol
6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol (PubChem CID 140608938) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol |
| PubChem CID | 140608938 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol |
| SMILES | CC(C)(C)C(O)C1CCCC(C)(C)C1O |
| InChI | InChI=1S/C13H26O2/c1-12(2,3)10(14)9-7-6-8-13(4,5)11(9)15/h9-11,14-15H,6-8H2,1-5H3 |
| InChIKey | JONLIEMLWDLLHI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol?
The IUPAC name of 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol (CID 140608938) is 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol.
What is the SMILES notation for 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol?
The canonical SMILES for 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol is CC(C)(C)C(O)C1CCCC(C)(C)C1O.
What is the InChIKey of 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol?
The InChIKey is JONLIEMLWDLLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-12(2,3)10(14)9-7-6-8-13(4,5)11(9)15/h9-11,14-15H,6-8H2,1-5H3.
What are the key properties of 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol?
6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol has a molecular weight of 214.35 g/mol, XLogP of 2.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-hydroxy-2,2-dimethylpropyl)-2,2-dimethylcyclohexan-1-ol is sourced from PubChem (CID 140608938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).