C17H15ClN6O4S — CID 140608976
N-[[[5-chloro-2-(3-nitroanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide (PubChem CID 140608976) has the molecular formula C17H15ClN6O4S and a molecular weight of 434.87 g/mol. Its IUPAC name is N-[[[5-chloro-2-(3-nitroanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide.
| Compound Name | N-[[[5-chloro-2-(3-nitroanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 140608976 |
| Molecular Formula | C17H15ClN6O4S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-[[[5-chloro-2-(3-nitroanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(Nc2ncc(Cl)c(NCNS(=O)(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C17H15ClN6O4S/c18-15-10-19-17(22-12-5-4-6-13(9-12)24(25)26)23-16(15)20-11-21-29(27,28)14-7-2-1-3-8-14/h1-10,21H,11H2,(H2,19,20,22,23) |
| InChIKey | GUIHCAUMWBBROB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|