C17H15ClFN5O2S — CID 163209617
3-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 163209617) has the molecular formula C17H15ClFN5O2S and a molecular weight of 407.86 g/mol. Its IUPAC name is 3-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 163209617 |
| Molecular Formula | C17H15ClFN5O2S |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 3-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2ncc(Cl)c(NCc3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C17H15ClFN5O2S/c18-15-10-22-17(23-13-5-2-6-14(8-13)27(20,25)26)24-16(15)21-9-11-3-1-4-12(19)7-11/h1-8,10H,9H2,(H2,20,25,26)(H2,21,22,23,24) |
| InChIKey | ICTRPEQEIVBTBB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |