About 4-(1,3-dithian-2-yl)-2,3-dihydrofuran
4-(1,3-dithian-2-yl)-2,3-dihydrofuran (PubChem CID 14060969) has the molecular formula C8H12OS2
and a molecular weight of 188.32 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-(1,3-dithian-2-yl)-2,3-dihydrofuran |
| PubChem CID | 14060969 |
| Molecular Formula | C8H12OS2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-2,3-dihydrofuran |
| SMILES | C1=C(C2SCCCS2)CCO1 |
| InChI | InChI=1S/C8H12OS2/c1-4-10-8(11-5-1)7-2-3-9-6-7/h6,8H,1-5H2 |
| InChIKey | YVRYFUFQYUJMSI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-dithian-2-yl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dithian-2-yl)-2,3-dihydrofuran?
The IUPAC name of 4-(1,3-dithian-2-yl)-2,3-dihydrofuran (CID 14060969) is 4-(1,3-dithian-2-yl)-2,3-dihydrofuran.
What is the SMILES notation for 4-(1,3-dithian-2-yl)-2,3-dihydrofuran?
The canonical SMILES for 4-(1,3-dithian-2-yl)-2,3-dihydrofuran is C1=C(C2SCCCS2)CCO1.
What is the InChIKey of 4-(1,3-dithian-2-yl)-2,3-dihydrofuran?
The InChIKey is YVRYFUFQYUJMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS2/c1-4-10-8(11-5-1)7-2-3-9-6-7/h6,8H,1-5H2.
What are the key properties of 4-(1,3-dithian-2-yl)-2,3-dihydrofuran?
4-(1,3-dithian-2-yl)-2,3-dihydrofuran has a molecular weight of 188.32 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dithian-2-yl)-2,3-dihydrofuran is sourced from PubChem (CID 14060969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).