C12H20OS2 — CID 176604484
2-[2-(cyclopentylidenemethoxy)ethyl]-1,4-dithiane (PubChem CID 176604484) has the molecular formula C12H20OS2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 2-[2-(cyclopentylidenemethoxy)ethyl]-1,4-dithiane.
| Compound Name | 2-[2-(cyclopentylidenemethoxy)ethyl]-1,4-dithiane |
|---|---|
| PubChem CID | 176604484 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-[2-(cyclopentylidenemethoxy)ethyl]-1,4-dithiane |
| SMILES | C(OCCC1CSCCS1)=C1CCCC1 |
| InChI | InChI=1S/C12H20OS2/c1-2-4-11(3-1)9-13-6-5-12-10-14-7-8-15-12/h9,12H,1-8,10H2 |
| InChIKey | NSHPMHVIVHDWBT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|