C30H29F3N2O2 — CID 140609826
(4Z)-4-[[3,3-dimethyl-1-(3-methylbutyl)-5-(trifluoromethyl)indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate (PubChem CID 140609826) has the molecular formula C30H29F3N2O2 and a molecular weight of 506.57 g/mol. Its IUPAC name is (4Z)-4-[[3,3-dimethyl-1-(3-methylbutyl)-5-(trifluoromethyl)indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[[3,3-dimethyl-1-(3-methylbutyl)-5-(trifluoromethyl)indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140609826 |
| Molecular Formula | C30H29F3N2O2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | (4Z)-4-[[3,3-dimethyl-1-(3-methylbutyl)-5-(trifluoromethyl)indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate |
| SMILES | CC(C)CC[N+]1=C(/C=C2\C(=O)C(c3cn(C)c4ccccc34)=C2[O-])C(C)(C)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C30H29F3N2O2/c1-17(2)12-13-35-24-11-10-18(30(31,32)33)14-22(24)29(3,4)25(35)15-20-27(36)26(28(20)37)21-16-34(5)23-9-7-6-8-19(21)23/h6-11,14-17H,12-13H2,1-5H3 |
| InChIKey | JRFSVNILANUJLX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|