C12H18NO4Y- — CID 140609860
(3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione;yttrium (PubChem CID 140609860) has the molecular formula C12H18NO4Y- and a molecular weight of 329.19 g/mol. Its IUPAC name is (3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione;yttrium.
| Compound Name | (3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione;yttrium |
|---|---|
| PubChem CID | 140609860 |
| Molecular Formula | C12H18NO4Y- |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione;yttrium |
| SMILES | [CH2-]CO[C@@H]1CCCC[C@H]1N1C(=O)C[C@@H](O)C1=O.[Y] |
| InChI | InChI=1S/C12H18NO4.Y/c1-2-17-10-6-4-3-5-8(10)13-11(15)7-9(14)12(13)16;/h8-10,14H,1-7H2;/q-1;/t8-,9-,10-;/m1./s1 |
| InChIKey | DIFJLNWQVJAZCK-RWDYHCJXSA-N |
| XLogP | 0.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|