C12H21F2N2O7+ — CID 140611367
[(1R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-1-carboxy-3,3-difluoropropyl]azanium (PubChem CID 140611367) has the molecular formula C12H21F2N2O7+ and a molecular weight of 343.30 g/mol. Its IUPAC name is [(1R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-1-carboxy-3,3-difluoropropyl]azanium.
| Compound Name | [(1R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-1-carboxy-3,3-difluoropropyl]azanium |
|---|---|
| PubChem CID | 140611367 |
| Molecular Formula | C12H21F2N2O7+ |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [(1R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-1-carboxy-3,3-difluoropropyl]azanium |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1C(F)(F)C[C@@H]([NH3+])C(=O)O |
| InChI | InChI=1S/C12H20F2N2O7/c1-4(18)16-7-9(20)8(19)6(3-17)23-10(7)12(13,14)2-5(15)11(21)22/h5-10,17,19-20H,2-3,15H2,1H3,(H,16,18)(H,21,22)/p+1/t5-,6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | BVDYZLLBYAUASS-JQRWTQJCSA-O |
| XLogP | -3.31 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |