C21H22ClN3O — CID 140611476
N-[1-chloro-1-(2,3-dimethylanilino)propyl]isoquinoline-4-carboxamide (PubChem CID 140611476) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is N-[1-chloro-1-(2,3-dimethylanilino)propyl]isoquinoline-4-carboxamide.
| Compound Name | N-[1-chloro-1-(2,3-dimethylanilino)propyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 140611476 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[1-chloro-1-(2,3-dimethylanilino)propyl]isoquinoline-4-carboxamide |
| SMILES | CCC(Cl)(NC(=O)c1cncc2ccccc12)Nc1cccc(C)c1C |
| InChI | InChI=1S/C21H22ClN3O/c1-4-21(22,24-19-11-7-8-14(2)15(19)3)25-20(26)18-13-23-12-16-9-5-6-10-17(16)18/h5-13,24H,4H2,1-3H3,(H,25,26) |
| InChIKey | VVXARRKXEUCMOF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|