C29H36O10 — CID 140616983
CID 140616983 (PubChem CID 140616983) has the molecular formula C29H36O10 and a molecular weight of 544.60 g/mol.
| Compound Name | CID 140616983 |
|---|---|
| PubChem CID | 140616983 |
| Molecular Formula | C29H36O10 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | — |
| SMILES | CC(=O)[C@H]1CCC2C3CC=C4C[C@H](O)C5(OC(=O)CCC(=O)O5)C5(OC(=O)CCC(=O)O5)[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H36O10/c1-15(30)18-6-7-19-17-5-4-16-14-21(31)28(36-22(32)8-9-23(33)37-28)29(38-24(34)10-11-25(35)39-29)27(16,3)20(17)12-13-26(18,19)2/h4,17-21,31H,5-14H2,1-3H3/t17?,18-,19?,20?,21+,26-,27+/m1/s1 |
| InChIKey | OVZVHBRVNPETMD-XMCYDNSWSA-N |
| XLogP | 2.89 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|