C21H28Br4O2 — CID 123432953
1-[(8S,9S,10R,13S,14S,17S)-1,1,2,2-tetrabromo-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 123432953) has the molecular formula C21H28Br4O2 and a molecular weight of 632.07 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S,17S)-1,1,2,2-tetrabromo-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,9S,10R,13S,14S,17S)-1,1,2,2-tetrabromo-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 123432953 |
| Molecular Formula | C21H28Br4O2 |
| Molecular Weight | 632.07 g/mol |
| Exact Mass | 627.88 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S,17S)-1,1,2,2-tetrabromo-3-hydroxy-10,13-dimethyl-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)C(Br)(Br)C(Br)(Br)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H28Br4O2/c1-11(26)14-6-7-15-13-5-4-12-10-17(27)20(22,23)21(24,25)19(12,3)16(13)8-9-18(14,15)2/h4,13-17,27H,5-10H2,1-3H3/t13-,14+,15-,16-,17?,18+,19-/m0/s1 |
| InChIKey | REPWEVPVRNSDAI-HTOHVPIZSA-N |
| XLogP | 6.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.07 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|