C36H38Sn2 — CID 140617332
[2,5-bis(4-phenylphenyl)-4-trimethylstannylphenyl]-trimethylstannane (PubChem CID 140617332) has the molecular formula C36H38Sn2 and a molecular weight of 708.12 g/mol. Its IUPAC name is [2,5-bis(4-phenylphenyl)-4-trimethylstannylphenyl]-trimethylstannane.
| Compound Name | [2,5-bis(4-phenylphenyl)-4-trimethylstannylphenyl]-trimethylstannane |
|---|---|
| PubChem CID | 140617332 |
| Molecular Formula | C36H38Sn2 |
| Molecular Weight | 708.12 g/mol |
| Exact Mass | 710.10 |
| IUPAC Name | [2,5-bis(4-phenylphenyl)-4-trimethylstannylphenyl]-trimethylstannane |
| SMILES | C[Sn](C)(C)c1cc(-c2ccc(-c3ccccc3)cc2)c([Sn](C)(C)C)cc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H20.6CH3.2Sn/c1-3-7-23(8-4-1)25-11-15-27(16-12-25)29-19-21-30(22-20-29)28-17-13-26(14-18-28)24-9-5-2-6-10-24;;;;;;;;/h1-19,22H;6*1H3;; |
| InChIKey | YIONCJWSGBCKPO-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.12 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |