C22H30N2O4 — CID 140621586
(2R)-2-[[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoyl]amino]-2-phenylacetic acid (PubChem CID 140621586) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2R)-2-[[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 140621586 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (2R)-2-[[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentanoyl]amino]-2-phenylacetic acid |
| SMILES | O=C(CCCC(=O)N1CCCC2CCCCC21)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O4/c25-19(23-21(22(27)28)17-9-2-1-3-10-17)13-6-14-20(26)24-15-7-11-16-8-4-5-12-18(16)24/h1-3,9-10,16,18,21H,4-8,11-15H2,(H,23,25)(H,27,28)/t16?,18?,21-/m1/s1 |
| InChIKey | UAHRZJOPZJRXTH-QYGXFBIXSA-N |
| XLogP | 3.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |