C8H13N2+ — CID 140621750
(3,6-dimethyl-2-methylidene-1-pyridinyl)azanium (PubChem CID 140621750) has the molecular formula C8H13N2+ and a molecular weight of 137.21 g/mol. Its IUPAC name is (3,6-dimethyl-2-methylidene-1-pyridinyl)azanium.
| Compound Name | (3,6-dimethyl-2-methylidene-1-pyridinyl)azanium |
|---|---|
| PubChem CID | 140621750 |
| Molecular Formula | C8H13N2+ |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | (3,6-dimethyl-2-methylidene-1-pyridinyl)azanium |
| SMILES | C=C1C(C)=CC=C(C)N1[NH3+] |
| InChI | InChI=1S/C8H12N2/c1-6-4-5-7(2)10(9)8(6)3/h4-5H,3,9H2,1-2H3/p+1 |
| InChIKey | UZKRRBPEDGHWJF-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 30.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |