C11H20N2 — CID 143110766
1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-(3-methylbut-2-en-2-yl)hydrazine (PubChem CID 143110766) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-(3-methylbut-2-en-2-yl)hydrazine.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-(3-methylbut-2-en-2-yl)hydrazine |
|---|---|
| PubChem CID | 143110766 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-(3-methylbut-2-en-2-yl)hydrazine |
| SMILES | C/C=C\C(=C/C)N(N)C(C)=C(C)C |
| InChI | InChI=1S/C11H20N2/c1-6-8-11(7-2)13(12)10(5)9(3)4/h6-8H,12H2,1-5H3/b8-6-,11-7+ |
| InChIKey | ULGRZLZPCXARJO-FAWHLJIPSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|