C8H14N2 — CID 118642058
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylhydrazine (PubChem CID 118642058) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylhydrazine.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylhydrazine |
|---|---|
| PubChem CID | 118642058 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylhydrazine |
| SMILES | C=C/C=C(\C=C/C)N(C)N |
| InChI | InChI=1S/C8H14N2/c1-4-6-8(7-5-2)10(3)9/h4-7H,1,9H2,2-3H3/b7-5-,8-6+ |
| InChIKey | KDCDGTIKMIXAOJ-CGXWXWIYSA-N |
| XLogP | 1.44 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|