C6H12N2 — CID 89411288
1-methyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine (PubChem CID 89411288) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-methyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine.
| Compound Name | 1-methyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 89411288 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1-methyl-1-[(2Z)-penta-2,4-dien-2-yl]hydrazine |
| SMILES | C=C/C=C(/C)N(C)N |
| InChI | InChI=1S/C6H12N2/c1-4-5-6(2)8(3)7/h4-5H,1,7H2,2-3H3/b6-5- |
| InChIKey | OTCHNJZTDCJQGL-WAYWQWQTSA-N |
| XLogP | 0.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|