C9H13LiN2 — CID 138984283
lithium 1,1,2-trimethyl-2-phenylhydrazine (PubChem CID 138984283) has the molecular formula C9H13LiN2 and a molecular weight of 156.16 g/mol. Its IUPAC name is lithium 1,1,2-trimethyl-2-phenylhydrazine.
| Compound Name | lithium 1,1,2-trimethyl-2-phenylhydrazine |
|---|---|
| PubChem CID | 138984283 |
| Molecular Formula | C9H13LiN2 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | lithium 1,1,2-trimethyl-2-phenylhydrazine |
| SMILES | CN(C)N(C)c1cc[c-]cc1.[Li+] |
| InChI | InChI=1S/C9H13N2.Li/c1-10(2)11(3)9-7-5-4-6-8-9;/h5-8H,1-3H3;/q-1;+1 |
| InChIKey | RYTPKKKHQGIDGA-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|