C8H10LiN — CID 23690260
lithium N,N-dimethylaniline (PubChem CID 23690260) has the molecular formula C8H10LiN and a molecular weight of 127.12 g/mol. Its IUPAC name is lithium N,N-dimethylaniline.
| Compound Name | lithium N,N-dimethylaniline |
|---|---|
| PubChem CID | 23690260 |
| Molecular Formula | C8H10LiN |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | lithium N,N-dimethylaniline |
| SMILES | CN(C)c1c[c-]ccc1.[Li+] |
| InChI | InChI=1S/C8H10N.Li/c1-9(2)8-6-4-3-5-7-8;/h3-4,6-7H,1-2H3;/q-1;+1 |
| InChIKey | SVCFUDRWEVNDAO-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|