C8H13LiN2 — CID 134905420
lithium cyclohexa-1,5-dien-1-yl(dimethylamino)azanide (PubChem CID 134905420) has the molecular formula C8H13LiN2 and a molecular weight of 144.15 g/mol. Its IUPAC name is lithium cyclohexa-1,5-dien-1-yl(dimethylamino)azanide.
| Compound Name | lithium cyclohexa-1,5-dien-1-yl(dimethylamino)azanide |
|---|---|
| PubChem CID | 134905420 |
| Molecular Formula | C8H13LiN2 |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | lithium cyclohexa-1,5-dien-1-yl(dimethylamino)azanide |
| SMILES | CN(C)[N-]C1=CCCC=C1.[Li+] |
| InChI | InChI=1S/C8H13N2.Li/c1-10(2)9-8-6-4-3-5-7-8;/h4,6-7H,3,5H2,1-2H3;/q-1;+1 |
| InChIKey | IKHLUVCKOXWOSN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|