C9H13N2Y- — CID 149050398
N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium (PubChem CID 149050398) has the molecular formula C9H13N2Y- and a molecular weight of 238.12 g/mol. Its IUPAC name is N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium.
| Compound Name | N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
|---|---|
| PubChem CID | 149050398 |
| Molecular Formula | C9H13N2Y- |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | N,N,3-trimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
| SMILES | C=C1C=CC(C)=[C-]N1N(C)C.[Y] |
| InChI | InChI=1S/C9H13N2.Y/c1-8-5-6-9(2)11(7-8)10(3)4;/h5-6H,2H2,1,3-4H3;/q-1; |
| InChIKey | HCOBCKYJYJFYTG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|