C10H14NY- — CID 58336289
3-ethyl-N,N-dimethylbenzene-5-id-1-amine;yttrium (PubChem CID 58336289) has the molecular formula C10H14NY- and a molecular weight of 237.13 g/mol. Its IUPAC name is 3-ethyl-N,N-dimethylbenzene-5-id-1-amine;yttrium.
| Compound Name | 3-ethyl-N,N-dimethylbenzene-5-id-1-amine;yttrium |
|---|---|
| PubChem CID | 58336289 |
| Molecular Formula | C10H14NY- |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 3-ethyl-N,N-dimethylbenzene-5-id-1-amine;yttrium |
| SMILES | CCc1c[c-]cc(N(C)C)c1.[Y] |
| InChI | InChI=1S/C10H14N.Y/c1-4-9-6-5-7-10(8-9)11(2)3;/h6-8H,4H2,1-3H3;/q-1; |
| InChIKey | LSDIEORONORCMN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|