C8H10FN — CID 148998664
3-fluoro-1,5-dimethyl-2-methylidenepyridine (PubChem CID 148998664) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is 3-fluoro-1,5-dimethyl-2-methylidenepyridine.
| Compound Name | 3-fluoro-1,5-dimethyl-2-methylidenepyridine |
|---|---|
| PubChem CID | 148998664 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 3-fluoro-1,5-dimethyl-2-methylidenepyridine |
| SMILES | C=C1C(F)=CC(C)=CN1C |
| InChI | InChI=1S/C8H10FN/c1-6-4-8(9)7(2)10(3)5-6/h4-5H,2H2,1,3H3 |
| InChIKey | IIAXYPBQAUYGEG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |