C8H12FN — CID 87450917
1-fluoro-4,5,6-trimethyl-2H-pyridine (PubChem CID 87450917) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is 1-fluoro-4,5,6-trimethyl-2H-pyridine.
| Compound Name | 1-fluoro-4,5,6-trimethyl-2H-pyridine |
|---|---|
| PubChem CID | 87450917 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 1-fluoro-4,5,6-trimethyl-2H-pyridine |
| SMILES | CC1=CCN(F)C(C)=C1C |
| InChI | InChI=1S/C8H12FN/c1-6-4-5-10(9)8(3)7(6)2/h4H,5H2,1-3H3 |
| InChIKey | CXLCMMLNVMQWGY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|