C12H20FN — CID 155001788
(3E,4E)-N-fluoro-N,5-dimethyl-3-propylidenehepta-1,4-dien-2-amine (PubChem CID 155001788) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is (3E,4E)-N-fluoro-N,5-dimethyl-3-propylidenehepta-1,4-dien-2-amine.
| Compound Name | (3E,4E)-N-fluoro-N,5-dimethyl-3-propylidenehepta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 155001788 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (3E,4E)-N-fluoro-N,5-dimethyl-3-propylidenehepta-1,4-dien-2-amine |
| SMILES | C=C(C(/C=C(\C)CC)=C/CC)N(C)F |
| InChI | InChI=1S/C12H20FN/c1-6-8-12(9-10(3)7-2)11(4)14(5)13/h8-9H,4,6-7H2,1-3,5H3/b10-9+,12-8+ |
| InChIKey | ZIJGMYCQXAMSAI-RSPOHRJYSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|