C10H14N2 — CID 123566008
N-methyl-3-methylidene-N-(methylideneamino)hepta-1,4,6-trien-2-amine (PubChem CID 123566008) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-methyl-3-methylidene-N-(methylideneamino)hepta-1,4,6-trien-2-amine.
| Compound Name | N-methyl-3-methylidene-N-(methylideneamino)hepta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 123566008 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-methyl-3-methylidene-N-(methylideneamino)hepta-1,4,6-trien-2-amine |
| SMILES | C=CC=CC(=C)C(=C)N(C)N=C |
| InChI | InChI=1S/C10H14N2/c1-6-7-8-9(2)10(3)12(5)11-4/h6-8H,1-4H2,5H3 |
| InChIKey | FKNXAPWRVDARII-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|