C10H18N2O — CID 143895839
ethane;N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]nitrous amide (PubChem CID 143895839) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is ethane;N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]nitrous amide.
| Compound Name | ethane;N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]nitrous amide |
|---|---|
| PubChem CID | 143895839 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | ethane;N-methyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]nitrous amide |
| SMILES | C=C/C=C(\C(=C)C)N(C)N=O.CC |
| InChI | InChI=1S/C8H12N2O.C2H6/c1-5-6-8(7(2)3)10(4)9-11;1-2/h5-6H,1-2H2,3-4H3;1-2H3/b8-6+; |
| InChIKey | SBJSPGOUNQZDEA-WVLIHFOGSA-N |
| XLogP | 3.27 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|