C9H18N2 — CID 146561432
1-[(3Z)-hexa-1,3-dien-2-yl]-1,2,2-trimethylhydrazine (PubChem CID 146561432) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-[(3Z)-hexa-1,3-dien-2-yl]-1,2,2-trimethylhydrazine.
| Compound Name | 1-[(3Z)-hexa-1,3-dien-2-yl]-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 146561432 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-[(3Z)-hexa-1,3-dien-2-yl]-1,2,2-trimethylhydrazine |
| SMILES | C=C(/C=C\CC)N(C)N(C)C |
| InChI | InChI=1S/C9H18N2/c1-6-7-8-9(2)11(5)10(3)4/h7-8H,2,6H2,1,3-5H3/b8-7- |
| InChIKey | VXMAHSBSLTYXSC-FPLPWBNLSA-N |
| XLogP | 1.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|